C29H31N3O2 — CID 3043720
5,5-diphenyl-3-[3-(4-phenylpiperidin-1-yl)propyl]imidazolidine-2,4-dione (PubChem CID 3043720) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 5,5-diphenyl-3-[3-(4-phenylpiperidin-1-yl)propyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-diphenyl-3-[3-(4-phenylpiperidin-1-yl)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 3043720 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 5,5-diphenyl-3-[3-(4-phenylpiperidin-1-yl)propyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1CCCN1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C29H31N3O2/c33-27-29(25-13-6-2-7-14-25,26-15-8-3-9-16-26)30-28(34)32(27)20-10-19-31-21-17-24(18-22-31)23-11-4-1-5-12-23/h1-9,11-16,24H,10,17-22H2,(H,30,34) |
| InChIKey | YOOUNLNKTHKXOV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|