C22H28ClN3O3 — CID 3043725
3-[3-(tert-butylamino)-2-hydroxypropyl]-5,5-diphenylimidazolidine-2,4-dione;hydrochloride (PubChem CID 3043725) has the molecular formula C22H28ClN3O3 and a molecular weight of 417.94 g/mol. Its IUPAC name is 3-[3-(tert-butylamino)-2-hydroxypropyl]-5,5-diphenylimidazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-[3-(tert-butylamino)-2-hydroxypropyl]-5,5-diphenylimidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 3043725 |
| Molecular Formula | C22H28ClN3O3 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-[3-(tert-butylamino)-2-hydroxypropyl]-5,5-diphenylimidazolidine-2,4-dione;hydrochloride |
| SMILES | CC(C)(C)NCC(O)CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O.Cl |
| InChI | InChI=1S/C22H27N3O3.ClH/c1-21(2,3)23-14-18(26)15-25-19(27)22(24-20(25)28,16-10-6-4-7-11-16)17-12-8-5-9-13-17;/h4-13,18,23,26H,14-15H2,1-3H3,(H,24,28);1H |
| InChIKey | QRKFTALEUCFDHF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|