C31H35N3O3 — CID 3043738
3-[3-(4-hydroxy-4-phenylpiperidin-1-yl)propyl]-5,5-bis(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 3043738) has the molecular formula C31H35N3O3 and a molecular weight of 497.64 g/mol. Its IUPAC name is 3-[3-(4-hydroxy-4-phenylpiperidin-1-yl)propyl]-5,5-bis(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[3-(4-hydroxy-4-phenylpiperidin-1-yl)propyl]-5,5-bis(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 3043738 |
| Molecular Formula | C31H35N3O3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | 3-[3-(4-hydroxy-4-phenylpiperidin-1-yl)propyl]-5,5-bis(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)NC(=O)N(CCCN3CCC(O)(c4ccccc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C31H35N3O3/c1-23-9-13-26(14-10-23)31(27-15-11-24(2)12-16-27)28(35)34(29(36)32-31)20-6-19-33-21-17-30(37,18-22-33)25-7-4-3-5-8-25/h3-5,7-16,37H,6,17-22H2,1-2H3,(H,32,36) |
| InChIKey | GMALMGHBFDAATJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|