C13H10N4O4S — CID 3043807
3-methyl-4-(3-nitrophenyl)pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide (PubChem CID 3043807) has the molecular formula C13H10N4O4S and a molecular weight of 318.31 g/mol. Its IUPAC name is 3-methyl-4-(3-nitrophenyl)pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide.
| Compound Name | 3-methyl-4-(3-nitrophenyl)pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 3043807 |
| Molecular Formula | C13H10N4O4S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 3-methyl-4-(3-nitrophenyl)pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide |
| SMILES | CC1=NS(=O)(=O)c2cnccc2N1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10N4O4S/c1-9-15-22(20,21)13-8-14-6-5-12(13)16(9)10-3-2-4-11(7-10)17(18)19/h2-8H,1H3 |
| InChIKey | GPCZIVVJTHVHNL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 105.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|