C18H26N2O — CID 3043829
3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-ethylpropan-1-amine (PubChem CID 3043829) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-ethylpropan-1-amine.
| Compound Name | 3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 3043829 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-(1,10-dimethyl-3,4-dihydro-[1,4]oxazino[4,3-a]indol-1-yl)-N-ethylpropan-1-amine |
| SMILES | CCNCCCC1(C)OCCn2c1c(C)c1ccccc12 |
| InChI | InChI=1S/C18H26N2O/c1-4-19-11-7-10-18(3)17-14(2)15-8-5-6-9-16(15)20(17)12-13-21-18/h5-6,8-9,19H,4,7,10-13H2,1-3H3 |
| InChIKey | CNLPRDWYSPNZCZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|