C18H15N3S — CID 3043860
6-methyl-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazine (PubChem CID 3043860) has the molecular formula C18H15N3S and a molecular weight of 305.41 g/mol. Its IUPAC name is 6-methyl-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazine.
| Compound Name | 6-methyl-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazine |
|---|---|
| PubChem CID | 3043860 |
| Molecular Formula | C18H15N3S |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 6-methyl-3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazine |
| SMILES | CC1=CSC2=NN=C(c3ccccc3)C(c3ccccc3)N12 |
| InChI | InChI=1S/C18H15N3S/c1-13-12-22-18-20-19-16(14-8-4-2-5-9-14)17(21(13)18)15-10-6-3-7-11-15/h2-12,17H,1H3 |
| InChIKey | DIXHOBFDGBYNJQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |