C17H13N3OS — CID 3043861
3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-6-one (PubChem CID 3043861) has the molecular formula C17H13N3OS and a molecular weight of 307.38 g/mol. Its IUPAC name is 3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-6-one.
| Compound Name | 3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 3043861 |
| Molecular Formula | C17H13N3OS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3,4-diphenyl-4H-[1,3]thiazolo[2,3-c][1,2,4]triazin-6-one |
| SMILES | O=C1CSC2=NN=C(c3ccccc3)C(c3ccccc3)N12 |
| InChI | InChI=1S/C17H13N3OS/c21-14-11-22-17-19-18-15(12-7-3-1-4-8-12)16(20(14)17)13-9-5-2-6-10-13/h1-10,16H,11H2 |
| InChIKey | IGZOFBDTFNGKGL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |