C15H18O5 — CID 3043895
(1aR,2R,2'S,3R,7bS)-2-hydroxy-2',3,3a-trimethyl-6-oxospiro[2,3,4,7b-tetrahydro-1aH-naphtho[1,2-b]oxirene-5,3'-oxirane]-2'-carbaldehyde (PubChem CID 3043895) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (1aR,2R,2'S,3R,7bS)-2-hydroxy-2',3,3a-trimethyl-6-oxospiro[2,3,4,7b-tetrahydro-1aH-naphtho[1,2-b]oxirene-5,3'-oxirane]-2'-carbaldehyde.
| Compound Name | (1aR,2R,2'S,3R,7bS)-2-hydroxy-2',3,3a-trimethyl-6-oxospiro[2,3,4,7b-tetrahydro-1aH-naphtho[1,2-b]oxirene-5,3'-oxirane]-2'-carbaldehyde |
|---|---|
| PubChem CID | 3043895 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (1aR,2R,2'S,3R,7bS)-2-hydroxy-2',3,3a-trimethyl-6-oxospiro[2,3,4,7b-tetrahydro-1aH-naphtho[1,2-b]oxirene-5,3'-oxirane]-2'-carbaldehyde |
| SMILES | C[C@H]1[C@@H](O)[C@H]2O[C@H]2C2=CC(=O)C3(CC21C)O[C@]3(C)C=O |
| InChI | InChI=1S/C15H18O5/c1-7-10(18)12-11(19-12)8-4-9(17)15(5-13(7,8)2)14(3,6-16)20-15/h4,6-7,10-12,18H,5H2,1-3H3/t7-,10+,11-,12+,13?,14+,15?/m0/s1 |
| InChIKey | JEEVPUIUWRQPCU-ZBEIYLNJSA-N |
| XLogP | 0.40 |
| TPSA | 79.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|