About [(3R,4R)-1-methyl-4-phenylpiperidin-3-yl] acetate;hydrochloride
[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl] acetate;hydrochloride (PubChem CID 3043901) has the molecular formula C14H20ClNO2
and a molecular weight of 269.77 g/mol. Its IUPAC name is [(3R,4R)-1-methyl-4-phenylpiperidin-3-yl] acetate;hydrochloride.
Molecular Properties
| Compound Name | [(3R,4R)-1-methyl-4-phenylpiperidin-3-yl] acetate;hydrochloride |
| PubChem CID | 3043901 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | [(3R,4R)-1-methyl-4-phenylpiperidin-3-yl] acetate;hydrochloride |
| SMILES | CC(=O)O[C@H]1CN(C)CC[C@@H]1c1ccccc1.Cl |
| InChI | InChI=1S/C14H19NO2.ClH/c1-11(16)17-14-10-15(2)9-8-13(14)12-6-4-3-5-7-12;/h3-7,13-14H,8-10H2,1-2H3;1H/t13-,14+;/m1./s1 |
| InChIKey | YTBRCDIZLLUWNP-DFQHDRSWSA-N |
| XLogP | 2.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R,4R)-1-methyl-4-phenylpiperidin-3-yl] acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-1-methyl-4-phenylpiperidin-3-yl] acetate;hydrochloride?
The IUPAC name of [(3R,4R)-1-methyl-4-phenylpiperidin-3-yl] acetate;hydrochloride (CID 3043901) is [(3R,4R)-1-methyl-4-phenylpiperidin-3-yl] acetate;hydrochloride.
What is the SMILES notation for [(3R,4R)-1-methyl-4-phenylpiperidin-3-yl] acetate;hydrochloride?
The canonical SMILES for [(3R,4R)-1-methyl-4-phenylpiperidin-3-yl] acetate;hydrochloride is CC(=O)O[C@H]1CN(C)CC[C@@H]1c1ccccc1.Cl.
What is the InChIKey of [(3R,4R)-1-methyl-4-phenylpiperidin-3-yl] acetate;hydrochloride?
The InChIKey is YTBRCDIZLLUWNP-DFQHDRSWSA-N. The full InChI is InChI=1S/C14H19NO2.ClH/c1-11(16)17-14-10-15(2)9-8-13(14)12-6-4-3-5-7-12;/h3-7,13-14H,8-10H2,1-2H3;1H/t13-,14+;/m1./s1.
What are the key properties of [(3R,4R)-1-methyl-4-phenylpiperidin-3-yl] acetate;hydrochloride?
[(3R,4R)-1-methyl-4-phenylpiperidin-3-yl] acetate;hydrochloride has a molecular weight of 269.77 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-1-methyl-4-phenylpiperidin-3-yl] acetate;hydrochloride is sourced from PubChem (CID 3043901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).