About 1-(diaminomethylidene)-3-(2,6-dichlorophenyl)urea;hydrochloride
1-(diaminomethylidene)-3-(2,6-dichlorophenyl)urea;hydrochloride (PubChem CID 3043987) has the molecular formula C8H9Cl3N4O
and a molecular weight of 283.55 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-(2,6-dichlorophenyl)urea;hydrochloride.
Molecular Properties
| Compound Name | 1-(diaminomethylidene)-3-(2,6-dichlorophenyl)urea;hydrochloride |
| PubChem CID | 3043987 |
| Molecular Formula | C8H9Cl3N4O |
| Molecular Weight | 283.55 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 1-(diaminomethylidene)-3-(2,6-dichlorophenyl)urea;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H8Cl2N4O.ClH/c9-4-2-1-3-5(10)6(4)13-8(15)14-7(11)12;/h1-3H,(H5,11,12,13,14,15);1H |
| InChIKey | HTCJMUQKDBWTBW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.55 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(diaminomethylidene)-3-(2,6-dichlorophenyl)urea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diaminomethylidene)-3-(2,6-dichlorophenyl)urea;hydrochloride?
The IUPAC name of 1-(diaminomethylidene)-3-(2,6-dichlorophenyl)urea;hydrochloride (CID 3043987) is 1-(diaminomethylidene)-3-(2,6-dichlorophenyl)urea;hydrochloride.
What is the SMILES notation for 1-(diaminomethylidene)-3-(2,6-dichlorophenyl)urea;hydrochloride?
The canonical SMILES for 1-(diaminomethylidene)-3-(2,6-dichlorophenyl)urea;hydrochloride is Cl.NC(N)=NC(=O)Nc1c(Cl)cccc1Cl.
What is the InChIKey of 1-(diaminomethylidene)-3-(2,6-dichlorophenyl)urea;hydrochloride?
The InChIKey is HTCJMUQKDBWTBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2N4O.ClH/c9-4-2-1-3-5(10)6(4)13-8(15)14-7(11)12;/h1-3H,(H5,11,12,13,14,15);1H.
What are the key properties of 1-(diaminomethylidene)-3-(2,6-dichlorophenyl)urea;hydrochloride?
1-(diaminomethylidene)-3-(2,6-dichlorophenyl)urea;hydrochloride has a molecular weight of 283.55 g/mol, XLogP of 2.22, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diaminomethylidene)-3-(2,6-dichlorophenyl)urea;hydrochloride is sourced from PubChem (CID 3043987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).