C18H26O3 — CID 3043997
6-[(1S,2S,3R)-3-hydroxy-2-(2-hydroxyethyl)-2-methylcyclopentyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 3043997) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 6-[(1S,2S,3R)-3-hydroxy-2-(2-hydroxyethyl)-2-methylcyclopentyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 6-[(1S,2S,3R)-3-hydroxy-2-(2-hydroxyethyl)-2-methylcyclopentyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 3043997 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 6-[(1S,2S,3R)-3-hydroxy-2-(2-hydroxyethyl)-2-methylcyclopentyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | C[C@@]1(CCO)[C@H](O)CC[C@H]1C1CCc2cc(O)ccc2C1 |
| InChI | InChI=1S/C18H26O3/c1-18(8-9-19)16(6-7-17(18)21)14-3-2-13-11-15(20)5-4-12(13)10-14/h4-5,11,14,16-17,19-21H,2-3,6-10H2,1H3/t14?,16-,17+,18-/m0/s1 |
| InChIKey | ZUYJNKZTFXYLDC-ONQFOCNCSA-N |
| XLogP | 2.66 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |