About pyrrolo[3,4-d]pyrimidine-5,7-dione
pyrrolo[3,4-d]pyrimidine-5,7-dione (PubChem CID 3044033) has the molecular formula C6H3N3O2
and a molecular weight of 149.11 g/mol. Its IUPAC name is pyrrolo[3,4-d]pyrimidine-5,7-dione.
Molecular Properties
| Compound Name | pyrrolo[3,4-d]pyrimidine-5,7-dione |
| PubChem CID | 3044033 |
| Molecular Formula | C6H3N3O2 |
| Molecular Weight | 149.11 g/mol |
| Exact Mass | 149.02 |
| IUPAC Name | pyrrolo[3,4-d]pyrimidine-5,7-dione |
| SMILES | O=C1NC(=O)c2ncncc21 |
| InChI | InChI=1S/C6H3N3O2/c10-5-3-1-7-2-8-4(3)6(11)9-5/h1-2H,(H,9,10,11) |
| InChIKey | BSXBDKGWSQDPPD-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.11 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze pyrrolo[3,4-d]pyrimidine-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[3,4-d]pyrimidine-5,7-dione?
The IUPAC name of pyrrolo[3,4-d]pyrimidine-5,7-dione (CID 3044033) is pyrrolo[3,4-d]pyrimidine-5,7-dione.
What is the SMILES notation for pyrrolo[3,4-d]pyrimidine-5,7-dione?
The canonical SMILES for pyrrolo[3,4-d]pyrimidine-5,7-dione is O=C1NC(=O)c2ncncc21.
What is the InChIKey of pyrrolo[3,4-d]pyrimidine-5,7-dione?
The InChIKey is BSXBDKGWSQDPPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3O2/c10-5-3-1-7-2-8-4(3)6(11)9-5/h1-2H,(H,9,10,11).
What are the key properties of pyrrolo[3,4-d]pyrimidine-5,7-dione?
pyrrolo[3,4-d]pyrimidine-5,7-dione has a molecular weight of 149.11 g/mol, XLogP of -0.64, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[3,4-d]pyrimidine-5,7-dione is sourced from PubChem (CID 3044033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).