C15H23NO3 — CID 3044070
3-cyclohexyl-5,5-diethyl-2-methylidene-1,3-oxazinane-4,6-dione (PubChem CID 3044070) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 3-cyclohexyl-5,5-diethyl-2-methylidene-1,3-oxazinane-4,6-dione.
| Compound Name | 3-cyclohexyl-5,5-diethyl-2-methylidene-1,3-oxazinane-4,6-dione |
|---|---|
| PubChem CID | 3044070 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 3-cyclohexyl-5,5-diethyl-2-methylidene-1,3-oxazinane-4,6-dione |
| SMILES | C=C1OC(=O)C(CC)(CC)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C15H23NO3/c1-4-15(5-2)13(17)16(11(3)19-14(15)18)12-9-7-6-8-10-12/h12H,3-10H2,1-2H3 |
| InChIKey | DRZFDUIONSEVKJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|