C22H27N3 — CID 3044276
N,N-dimethyl-9-(4-methylpiperazin-1-yl)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine (PubChem CID 3044276) has the molecular formula C22H27N3 and a molecular weight of 333.48 g/mol. Its IUPAC name is N,N-dimethyl-9-(4-methylpiperazin-1-yl)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine.
| Compound Name | N,N-dimethyl-9-(4-methylpiperazin-1-yl)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine |
|---|---|
| PubChem CID | 3044276 |
| Molecular Formula | C22H27N3 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | N,N-dimethyl-9-(4-methylpiperazin-1-yl)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine |
| SMILES | CN1CCN(C2=Cc3ccccc3C(N(C)C)c3ccccc32)CC1 |
| InChI | InChI=1S/C22H27N3/c1-23(2)22-18-9-5-4-8-17(18)16-21(19-10-6-7-11-20(19)22)25-14-12-24(3)13-15-25/h4-11,16,22H,12-15H2,1-3H3 |
| InChIKey | OPSXBPZMCINMFH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|