2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid

C12H14O2 — CID 3044360

IUPAC2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid
SMILESCC1Cc2ccc(CC(=O)O)cc2C1
InChIInChI=1S/C12H14O2/c1-8-4-10-3-2-9(7-12(13)14)6-11(10)5-8/h2-3,6,8H,4-5,7H2,1H3,(H,13,14)
InChIKeySEWYKXUDXKEOBR-UHFFFAOYSA-N
MW190.24 g/mol
LogP2.05
Rot. Bonds2

About 2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid

2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid (PubChem CID 3044360) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid.

Molecular Properties

Compound Name2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid
PubChem CID3044360
Molecular FormulaC12H14O2
Molecular Weight190.24 g/mol
Exact Mass190.10
IUPAC Name2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid
SMILESCC1Cc2ccc(CC(=O)O)cc2C1
InChIInChI=1S/C12H14O2/c1-8-4-10-3-2-9(7-12(13)14)6-11(10)5-8/h2-3,6,8H,4-5,7H2,1H3,(H,13,14)
InChIKeySEWYKXUDXKEOBR-UHFFFAOYSA-N
XLogP2.05
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.24
LogP ≤ 52.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid?
The IUPAC name of 2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid (CID 3044360) is 2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid.
What is the SMILES notation for 2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid?
The canonical SMILES for 2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid is CC1Cc2ccc(CC(=O)O)cc2C1.
What is the InChIKey of 2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid?
The InChIKey is SEWYKXUDXKEOBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-8-4-10-3-2-9(7-12(13)14)6-11(10)5-8/h2-3,6,8H,4-5,7H2,1H3,(H,13,14).
What are the key properties of 2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid?
2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid has a molecular weight of 190.24 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-2,3-dihydro-1H-inden-5-yl)acetic acid is sourced from PubChem (CID 3044360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).