About propyl (3R,4S)-1-methyl-4-phenylpiperidine-3-carboxylate;hydrobromide
propyl (3R,4S)-1-methyl-4-phenylpiperidine-3-carboxylate;hydrobromide (PubChem CID 3044370) has the molecular formula C16H24BrNO2
and a molecular weight of 342.28 g/mol. Its IUPAC name is propyl (3R,4S)-1-methyl-4-phenylpiperidine-3-carboxylate;hydrobromide.
Molecular Properties
| Compound Name | propyl (3R,4S)-1-methyl-4-phenylpiperidine-3-carboxylate;hydrobromide |
| PubChem CID | 3044370 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | propyl (3R,4S)-1-methyl-4-phenylpiperidine-3-carboxylate;hydrobromide |
| SMILES | Br.CCCOC(=O)[C@H]1CN(C)CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H23NO2.BrH/c1-3-11-19-16(18)15-12-17(2)10-9-14(15)13-7-5-4-6-8-13;/h4-8,14-15H,3,9-12H2,1-2H3;1H/t14-,15+;/m1./s1 |
| InChIKey | XIPOFIKFJDIYEZ-LIOBNPLQSA-N |
| XLogP | 3.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propyl (3R,4S)-1-methyl-4-phenylpiperidine-3-carboxylate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl (3R,4S)-1-methyl-4-phenylpiperidine-3-carboxylate;hydrobromide?
The IUPAC name of propyl (3R,4S)-1-methyl-4-phenylpiperidine-3-carboxylate;hydrobromide (CID 3044370) is propyl (3R,4S)-1-methyl-4-phenylpiperidine-3-carboxylate;hydrobromide.
What is the SMILES notation for propyl (3R,4S)-1-methyl-4-phenylpiperidine-3-carboxylate;hydrobromide?
The canonical SMILES for propyl (3R,4S)-1-methyl-4-phenylpiperidine-3-carboxylate;hydrobromide is Br.CCCOC(=O)[C@H]1CN(C)CC[C@@H]1c1ccccc1.
What is the InChIKey of propyl (3R,4S)-1-methyl-4-phenylpiperidine-3-carboxylate;hydrobromide?
The InChIKey is XIPOFIKFJDIYEZ-LIOBNPLQSA-N. The full InChI is InChI=1S/C16H23NO2.BrH/c1-3-11-19-16(18)15-12-17(2)10-9-14(15)13-7-5-4-6-8-13;/h4-8,14-15H,3,9-12H2,1-2H3;1H/t14-,15+;/m1./s1.
What are the key properties of propyl (3R,4S)-1-methyl-4-phenylpiperidine-3-carboxylate;hydrobromide?
propyl (3R,4S)-1-methyl-4-phenylpiperidine-3-carboxylate;hydrobromide has a molecular weight of 342.28 g/mol, XLogP of 3.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl (3R,4S)-1-methyl-4-phenylpiperidine-3-carboxylate;hydrobromide is sourced from PubChem (CID 3044370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).