C17H21NO4 — CID 3044481
(3,4-dimethyl-2-pyridinyl)-(3,4,5-trimethoxyphenyl)methanol (PubChem CID 3044481) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is (3,4-dimethyl-2-pyridinyl)-(3,4,5-trimethoxyphenyl)methanol.
| Compound Name | (3,4-dimethyl-2-pyridinyl)-(3,4,5-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 3044481 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (3,4-dimethyl-2-pyridinyl)-(3,4,5-trimethoxyphenyl)methanol |
| SMILES | COc1cc(C(O)c2nccc(C)c2C)cc(OC)c1OC |
| InChI | InChI=1S/C17H21NO4/c1-10-6-7-18-15(11(10)2)16(19)12-8-13(20-3)17(22-5)14(9-12)21-4/h6-9,16,19H,1-5H3 |
| InChIKey | UMGQVIOGHDLFBI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |