About 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid;sulfuric acid
4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid;sulfuric acid (PubChem CID 3044627) has the molecular formula C13H19ClN2O6S
and a molecular weight of 366.82 g/mol. Its IUPAC name is 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid;sulfuric acid.
Molecular Properties
| Compound Name | 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid;sulfuric acid |
| PubChem CID | 3044627 |
| Molecular Formula | C13H19ClN2O6S |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid;sulfuric acid |
| SMILES | NC1(C(=O)O)CCN(Cc2ccc(Cl)cc2)CC1.O=S(=O)(O)O |
| InChI | InChI=1S/C13H17ClN2O2.H2O4S/c14-11-3-1-10(2-4-11)9-16-7-5-13(15,6-8-16)12(17)18;1-5(2,3)4/h1-4H,5-9,15H2,(H,17,18);(H2,1,2,3,4) |
| InChIKey | SFWLTAYWMDYHDB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid;sulfuric acid?
The IUPAC name of 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid;sulfuric acid (CID 3044627) is 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid;sulfuric acid.
What is the SMILES notation for 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid;sulfuric acid?
The canonical SMILES for 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid;sulfuric acid is NC1(C(=O)O)CCN(Cc2ccc(Cl)cc2)CC1.O=S(=O)(O)O.
What is the InChIKey of 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid;sulfuric acid?
The InChIKey is SFWLTAYWMDYHDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2O2.H2O4S/c14-11-3-1-10(2-4-11)9-16-7-5-13(15,6-8-16)12(17)18;1-5(2,3)4/h1-4H,5-9,15H2,(H,17,18);(H2,1,2,3,4).
What are the key properties of 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid;sulfuric acid?
4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid;sulfuric acid has a molecular weight of 366.82 g/mol, XLogP of 1.07, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-[(4-chlorophenyl)methyl]piperidine-4-carboxylic acid;sulfuric acid is sourced from PubChem (CID 3044627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).