About octyl 4-amino-1-benzylpiperidine-4-carboxylate;oxalic acid
octyl 4-amino-1-benzylpiperidine-4-carboxylate;oxalic acid (PubChem CID 3044647) has the molecular formula C23H36N2O6
and a molecular weight of 436.55 g/mol. Its IUPAC name is octyl 4-amino-1-benzylpiperidine-4-carboxylate;oxalic acid.
Molecular Properties
| Compound Name | octyl 4-amino-1-benzylpiperidine-4-carboxylate;oxalic acid |
| PubChem CID | 3044647 |
| Molecular Formula | C23H36N2O6 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | octyl 4-amino-1-benzylpiperidine-4-carboxylate;oxalic acid |
| SMILES | CCCCCCCCOC(=O)C1(N)CCN(Cc2ccccc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H34N2O2.C2H2O4/c1-2-3-4-5-6-10-17-25-20(24)21(22)13-15-23(16-14-21)18-19-11-8-7-9-12-19;3-1(4)2(5)6/h7-9,11-12H,2-6,10,13-18,22H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | COSQJVNQGWDNFM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze octyl 4-amino-1-benzylpiperidine-4-carboxylate;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl 4-amino-1-benzylpiperidine-4-carboxylate;oxalic acid?
The IUPAC name of octyl 4-amino-1-benzylpiperidine-4-carboxylate;oxalic acid (CID 3044647) is octyl 4-amino-1-benzylpiperidine-4-carboxylate;oxalic acid.
What is the SMILES notation for octyl 4-amino-1-benzylpiperidine-4-carboxylate;oxalic acid?
The canonical SMILES for octyl 4-amino-1-benzylpiperidine-4-carboxylate;oxalic acid is CCCCCCCCOC(=O)C1(N)CCN(Cc2ccccc2)CC1.O=C(O)C(=O)O.
What is the InChIKey of octyl 4-amino-1-benzylpiperidine-4-carboxylate;oxalic acid?
The InChIKey is COSQJVNQGWDNFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34N2O2.C2H2O4/c1-2-3-4-5-6-10-17-25-20(24)21(22)13-15-23(16-14-21)18-19-11-8-7-9-12-19;3-1(4)2(5)6/h7-9,11-12H,2-6,10,13-18,22H2,1H3;(H,3,4)(H,5,6).
What are the key properties of octyl 4-amino-1-benzylpiperidine-4-carboxylate;oxalic acid?
octyl 4-amino-1-benzylpiperidine-4-carboxylate;oxalic acid has a molecular weight of 436.55 g/mol, XLogP of 3.04, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for octyl 4-amino-1-benzylpiperidine-4-carboxylate;oxalic acid is sourced from PubChem (CID 3044647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).