C19H30BrNO2 — CID 3044674
5,6-dimethoxy-3-(2-methylbutyl)-1,2,4,7,8,9-hexahydrocyclopenta[f]isoquinoline;hydrobromide (PubChem CID 3044674) has the molecular formula C19H30BrNO2 and a molecular weight of 384.36 g/mol. Its IUPAC name is 5,6-dimethoxy-3-(2-methylbutyl)-1,2,4,7,8,9-hexahydrocyclopenta[f]isoquinoline;hydrobromide.
| Compound Name | 5,6-dimethoxy-3-(2-methylbutyl)-1,2,4,7,8,9-hexahydrocyclopenta[f]isoquinoline;hydrobromide |
|---|---|
| PubChem CID | 3044674 |
| Molecular Formula | C19H30BrNO2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 5,6-dimethoxy-3-(2-methylbutyl)-1,2,4,7,8,9-hexahydrocyclopenta[f]isoquinoline;hydrobromide |
| SMILES | Br.CCC(C)CN1CCc2c3c(c(OC)c(OC)c2C1)CCC3 |
| InChI | InChI=1S/C19H29NO2.BrH/c1-5-13(2)11-20-10-9-15-14-7-6-8-16(14)18(21-3)19(22-4)17(15)12-20;/h13H,5-12H2,1-4H3;1H |
| InChIKey | XNYYMJHUCYHHSS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |