C12H14N4S — CID 3044744
4-benzylsulfanyl-N,6-dimethyl-1,3,5-triazin-2-amine (PubChem CID 3044744) has the molecular formula C12H14N4S and a molecular weight of 246.34 g/mol. Its IUPAC name is 4-benzylsulfanyl-N,6-dimethyl-1,3,5-triazin-2-amine.
| Compound Name | 4-benzylsulfanyl-N,6-dimethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 3044744 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-benzylsulfanyl-N,6-dimethyl-1,3,5-triazin-2-amine |
| SMILES | CNc1nc(C)nc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C12H14N4S/c1-9-14-11(13-2)16-12(15-9)17-8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3,(H,13,14,15,16) |
| InChIKey | NQYBYIJBNCZHIN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |