C14H20ClNO — CID 3044778
3-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine;hydrochloride (PubChem CID 3044778) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is 3-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine;hydrochloride.
| Compound Name | 3-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine;hydrochloride |
|---|---|
| PubChem CID | 3044778 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-phenyl-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine;hydrochloride |
| SMILES | Cl.c1ccc(C2CN3CCCCC3CO2)cc1 |
| InChI | InChI=1S/C14H19NO.ClH/c1-2-6-12(7-3-1)14-10-15-9-5-4-8-13(15)11-16-14;/h1-3,6-7,13-14H,4-5,8-11H2;1H |
| InChIKey | JNNHKVQAGPQSDW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |