C21H25N5OS — CID 30449673
3-[(4-methylpiperazin-1-yl)methyl]-4-(4-phenylmethoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 30449673) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is 3-[(4-methylpiperazin-1-yl)methyl]-4-(4-phenylmethoxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(4-methylpiperazin-1-yl)methyl]-4-(4-phenylmethoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 30449673 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 3-[(4-methylpiperazin-1-yl)methyl]-4-(4-phenylmethoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CN1CCN(Cc2n[nH]c(=S)n2-c2ccc(OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C21H25N5OS/c1-24-11-13-25(14-12-24)15-20-22-23-21(28)26(20)18-7-9-19(10-8-18)27-16-17-5-3-2-4-6-17/h2-10H,11-16H2,1H3,(H,23,28) |
| InChIKey | BMECUTRAIIGEBM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|