C14H18O3S — CID 30449795
methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate (PubChem CID 30449795) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate.
| Compound Name | methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate |
|---|---|
| PubChem CID | 30449795 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate |
| SMILES | COC(=O)CCCCc1cc2c(s1)CCCC2=O |
| InChI | InChI=1S/C14H18O3S/c1-17-14(16)8-3-2-5-10-9-11-12(15)6-4-7-13(11)18-10/h9H,2-8H2,1H3 |
| InChIKey | RDMNHXZACLTULV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|