methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate

C14H18O3S — CID 30449795

IUPACmethyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate
SMILESCOC(=O)CCCCc1cc2c(s1)CCCC2=O
InChIInChI=1S/C14H18O3S/c1-17-14(16)8-3-2-5-10-9-11-12(15)6-4-7-13(11)18-10/h9H,2-8H2,1H3
InChIKeyRDMNHXZACLTULV-UHFFFAOYSA-N
MW266.36 g/mol
LogP3.15
Rot. Bonds5

About methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate

methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate (PubChem CID 30449795) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate.

Molecular Properties

Compound Namemethyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate
PubChem CID30449795
Molecular FormulaC14H18O3S
Molecular Weight266.36 g/mol
Exact Mass266.10
IUPAC Namemethyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate
SMILESCOC(=O)CCCCc1cc2c(s1)CCCC2=O
InChIInChI=1S/C14H18O3S/c1-17-14(16)8-3-2-5-10-9-11-12(15)6-4-7-13(11)18-10/h9H,2-8H2,1H3
InChIKeyRDMNHXZACLTULV-UHFFFAOYSA-N
XLogP3.15
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.36
LogP ≤ 53.15
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate?
The IUPAC name of methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate (CID 30449795) is methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate.
What is the SMILES notation for methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate?
The canonical SMILES for methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate is COC(=O)CCCCc1cc2c(s1)CCCC2=O.
What is the InChIKey of methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate?
The InChIKey is RDMNHXZACLTULV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3S/c1-17-14(16)8-3-2-5-10-9-11-12(15)6-4-7-13(11)18-10/h9H,2-8H2,1H3.
What are the key properties of methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate?
methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate has a molecular weight of 266.36 g/mol, XLogP of 3.15, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(4-oxo-6,7-dihydro-5H-1-benzothiophen-2-yl)pentanoate is sourced from PubChem (CID 30449795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).