C20H27NO4 — CID 30453199
(E)-N-cyclooctyl-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide (PubChem CID 30453199) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (E)-N-cyclooctyl-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide.
| Compound Name | (E)-N-cyclooctyl-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 30453199 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (E)-N-cyclooctyl-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NC2CCCCCCC2)cc2c1OCCO2 |
| InChI | InChI=1S/C20H27NO4/c1-23-17-13-15(14-18-20(17)25-12-11-24-18)9-10-19(22)21-16-7-5-3-2-4-6-8-16/h9-10,13-14,16H,2-8,11-12H2,1H3,(H,21,22)/b10-9+ |
| InChIKey | QNJRAWBLRUWGHZ-MDZDMXLPSA-N |
| XLogP | 3.71 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|