About 2,5-bis(chloromethyl)-1-methylpyrrolidine;hydrochloride
2,5-bis(chloromethyl)-1-methylpyrrolidine;hydrochloride (PubChem CID 3045349) has the molecular formula C7H14Cl3N
and a molecular weight of 218.55 g/mol. Its IUPAC name is 2,5-bis(chloromethyl)-1-methylpyrrolidine;hydrochloride.
Molecular Properties
| Compound Name | 2,5-bis(chloromethyl)-1-methylpyrrolidine;hydrochloride |
| PubChem CID | 3045349 |
| Molecular Formula | C7H14Cl3N |
| Molecular Weight | 218.55 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | 2,5-bis(chloromethyl)-1-methylpyrrolidine;hydrochloride |
| SMILES | CN1C(CCl)CCC1CCl.Cl |
| InChI | InChI=1S/C7H13Cl2N.ClH/c1-10-6(4-8)2-3-7(10)5-9;/h6-7H,2-5H2,1H3;1H |
| InChIKey | CSXVRNOQBUCLJC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.55 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(chloromethyl)-1-methylpyrrolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(chloromethyl)-1-methylpyrrolidine;hydrochloride?
The IUPAC name of 2,5-bis(chloromethyl)-1-methylpyrrolidine;hydrochloride (CID 3045349) is 2,5-bis(chloromethyl)-1-methylpyrrolidine;hydrochloride.
What is the SMILES notation for 2,5-bis(chloromethyl)-1-methylpyrrolidine;hydrochloride?
The canonical SMILES for 2,5-bis(chloromethyl)-1-methylpyrrolidine;hydrochloride is CN1C(CCl)CCC1CCl.Cl.
What is the InChIKey of 2,5-bis(chloromethyl)-1-methylpyrrolidine;hydrochloride?
The InChIKey is CSXVRNOQBUCLJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13Cl2N.ClH/c1-10-6(4-8)2-3-7(10)5-9;/h6-7H,2-5H2,1H3;1H.
What are the key properties of 2,5-bis(chloromethyl)-1-methylpyrrolidine;hydrochloride?
2,5-bis(chloromethyl)-1-methylpyrrolidine;hydrochloride has a molecular weight of 218.55 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(chloromethyl)-1-methylpyrrolidine;hydrochloride is sourced from PubChem (CID 3045349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).