About 1,3-dibenzylcyclooctane
1,3-dibenzylcyclooctane (PubChem CID 3045388) has the molecular formula C22H28
and a molecular weight of 292.47 g/mol. Its IUPAC name is 1,3-dibenzylcyclooctane.
Molecular Properties
| Compound Name | 1,3-dibenzylcyclooctane |
| PubChem CID | 3045388 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1,3-dibenzylcyclooctane |
| SMILES | c1ccc(CC2CCCCCC(Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C22H28/c1-4-10-19(11-5-1)16-21-14-8-3-9-15-22(18-21)17-20-12-6-2-7-13-20/h1-2,4-7,10-13,21-22H,3,8-9,14-18H2 |
| InChIKey | ZFXBBFYZXNUGPK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-dibenzylcyclooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibenzylcyclooctane?
The IUPAC name of 1,3-dibenzylcyclooctane (CID 3045388) is 1,3-dibenzylcyclooctane.
What is the SMILES notation for 1,3-dibenzylcyclooctane?
The canonical SMILES for 1,3-dibenzylcyclooctane is c1ccc(CC2CCCCCC(Cc3ccccc3)C2)cc1.
What is the InChIKey of 1,3-dibenzylcyclooctane?
The InChIKey is ZFXBBFYZXNUGPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28/c1-4-10-19(11-5-1)16-21-14-8-3-9-15-22(18-21)17-20-12-6-2-7-13-20/h1-2,4-7,10-13,21-22H,3,8-9,14-18H2.
What are the key properties of 1,3-dibenzylcyclooctane?
1,3-dibenzylcyclooctane has a molecular weight of 292.47 g/mol, XLogP of 6.06, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibenzylcyclooctane is sourced from PubChem (CID 3045388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).