About 2-ethyl-1,3-dihydrobenzo[f]isoindole;hydrobromide
2-ethyl-1,3-dihydrobenzo[f]isoindole;hydrobromide (PubChem CID 3045452) has the molecular formula C14H16BrN
and a molecular weight of 278.19 g/mol. Its IUPAC name is 2-ethyl-1,3-dihydrobenzo[f]isoindole;hydrobromide.
Molecular Properties
| Compound Name | 2-ethyl-1,3-dihydrobenzo[f]isoindole;hydrobromide |
| PubChem CID | 3045452 |
| Molecular Formula | C14H16BrN |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-ethyl-1,3-dihydrobenzo[f]isoindole;hydrobromide |
| SMILES | Br.CCN1Cc2cc3ccccc3cc2C1 |
| InChI | InChI=1S/C14H15N.BrH/c1-2-15-9-13-7-11-5-3-4-6-12(11)8-14(13)10-15;/h3-8H,2,9-10H2,1H3;1H |
| InChIKey | WHZNGSBYOLQCKL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-1,3-dihydrobenzo[f]isoindole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,3-dihydrobenzo[f]isoindole;hydrobromide?
The IUPAC name of 2-ethyl-1,3-dihydrobenzo[f]isoindole;hydrobromide (CID 3045452) is 2-ethyl-1,3-dihydrobenzo[f]isoindole;hydrobromide.
What is the SMILES notation for 2-ethyl-1,3-dihydrobenzo[f]isoindole;hydrobromide?
The canonical SMILES for 2-ethyl-1,3-dihydrobenzo[f]isoindole;hydrobromide is Br.CCN1Cc2cc3ccccc3cc2C1.
What is the InChIKey of 2-ethyl-1,3-dihydrobenzo[f]isoindole;hydrobromide?
The InChIKey is WHZNGSBYOLQCKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N.BrH/c1-2-15-9-13-7-11-5-3-4-6-12(11)8-14(13)10-15;/h3-8H,2,9-10H2,1H3;1H.
What are the key properties of 2-ethyl-1,3-dihydrobenzo[f]isoindole;hydrobromide?
2-ethyl-1,3-dihydrobenzo[f]isoindole;hydrobromide has a molecular weight of 278.19 g/mol, XLogP of 3.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,3-dihydrobenzo[f]isoindole;hydrobromide is sourced from PubChem (CID 3045452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).