About 1-(2,3-difluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;methanesulfonic acid
1-(2,3-difluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;methanesulfonic acid (PubChem CID 3045478) has the molecular formula C20H22F2N2O3S2
and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-(2,3-difluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;methanesulfonic acid.
Molecular Properties
| Compound Name | 1-(2,3-difluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;methanesulfonic acid |
| PubChem CID | 3045478 |
| Molecular Formula | C20H22F2N2O3S2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 1-(2,3-difluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;methanesulfonic acid |
| SMILES | CN1CCN(C2=Cc3ccccc3Sc3cc(F)c(F)cc32)CC1.CS(=O)(=O)O |
| InChI | InChI=1S/C19H18F2N2S.CH4O3S/c1-22-6-8-23(9-7-22)17-10-13-4-2-3-5-18(13)24-19-12-16(21)15(20)11-14(17)19;1-5(2,3)4/h2-5,10-12H,6-9H2,1H3;1H3,(H,2,3,4) |
| InChIKey | OYKXYDYQFGMEKY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_ene_A(8)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-difluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-difluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;methanesulfonic acid?
The IUPAC name of 1-(2,3-difluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;methanesulfonic acid (CID 3045478) is 1-(2,3-difluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;methanesulfonic acid.
What is the SMILES notation for 1-(2,3-difluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;methanesulfonic acid?
The canonical SMILES for 1-(2,3-difluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;methanesulfonic acid is CN1CCN(C2=Cc3ccccc3Sc3cc(F)c(F)cc32)CC1.CS(=O)(=O)O.
What is the InChIKey of 1-(2,3-difluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;methanesulfonic acid?
The InChIKey is OYKXYDYQFGMEKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18F2N2S.CH4O3S/c1-22-6-8-23(9-7-22)17-10-13-4-2-3-5-18(13)24-19-12-16(21)15(20)11-14(17)19;1-5(2,3)4/h2-5,10-12H,6-9H2,1H3;1H3,(H,2,3,4).
What are the key properties of 1-(2,3-difluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;methanesulfonic acid?
1-(2,3-difluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;methanesulfonic acid has a molecular weight of 440.54 g/mol, XLogP of 3.68, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-difluorobenzo[b][1]benzothiepin-5-yl)-4-methylpiperazine;methanesulfonic acid is sourced from PubChem (CID 3045478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).