About 1-carbamimidoyl-1-(4-ethyl-1,2-oxazol-3-yl)guanidine
1-carbamimidoyl-1-(4-ethyl-1,2-oxazol-3-yl)guanidine (PubChem CID 3045545) has the molecular formula C7H12N6O
and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-carbamimidoyl-1-(4-ethyl-1,2-oxazol-3-yl)guanidine.
Molecular Properties
| Compound Name | 1-carbamimidoyl-1-(4-ethyl-1,2-oxazol-3-yl)guanidine |
| PubChem CID | 3045545 |
| Molecular Formula | C7H12N6O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1-carbamimidoyl-1-(4-ethyl-1,2-oxazol-3-yl)guanidine |
| SMILES | [H]/N=C(\N)N(/C(N)=N/[H])c1nocc1CC |
| InChI | InChI=1S/C7H12N6O/c1-2-4-3-14-12-5(4)13(6(8)9)7(10)11/h3H,2H2,1H3,(H3,8,9)(H3,10,11) |
| InChIKey | AGWIJIWHKDETBI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 129.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamimidoyl-1-(4-ethyl-1,2-oxazol-3-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamimidoyl-1-(4-ethyl-1,2-oxazol-3-yl)guanidine?
The IUPAC name of 1-carbamimidoyl-1-(4-ethyl-1,2-oxazol-3-yl)guanidine (CID 3045545) is 1-carbamimidoyl-1-(4-ethyl-1,2-oxazol-3-yl)guanidine.
What is the SMILES notation for 1-carbamimidoyl-1-(4-ethyl-1,2-oxazol-3-yl)guanidine?
The canonical SMILES for 1-carbamimidoyl-1-(4-ethyl-1,2-oxazol-3-yl)guanidine is [H]/N=C(\N)N(/C(N)=N/[H])c1nocc1CC.
What is the InChIKey of 1-carbamimidoyl-1-(4-ethyl-1,2-oxazol-3-yl)guanidine?
The InChIKey is AGWIJIWHKDETBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N6O/c1-2-4-3-14-12-5(4)13(6(8)9)7(10)11/h3H,2H2,1H3,(H3,8,9)(H3,10,11).
What are the key properties of 1-carbamimidoyl-1-(4-ethyl-1,2-oxazol-3-yl)guanidine?
1-carbamimidoyl-1-(4-ethyl-1,2-oxazol-3-yl)guanidine has a molecular weight of 196.21 g/mol, XLogP of -0.17, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamimidoyl-1-(4-ethyl-1,2-oxazol-3-yl)guanidine is sourced from PubChem (CID 3045545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).