About 6-(methylamino)-5,6-dihydrobenzo[b][1]benzothiepine-2,3-diol;hydrobromide
6-(methylamino)-5,6-dihydrobenzo[b][1]benzothiepine-2,3-diol;hydrobromide (PubChem CID 3045604) has the molecular formula C15H16BrNO2S
and a molecular weight of 354.27 g/mol. Its IUPAC name is 6-(methylamino)-5,6-dihydrobenzo[b][1]benzothiepine-2,3-diol;hydrobromide.
Molecular Properties
| Compound Name | 6-(methylamino)-5,6-dihydrobenzo[b][1]benzothiepine-2,3-diol;hydrobromide |
| PubChem CID | 3045604 |
| Molecular Formula | C15H16BrNO2S |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 6-(methylamino)-5,6-dihydrobenzo[b][1]benzothiepine-2,3-diol;hydrobromide |
| SMILES | Br.CNC1Cc2cc(O)c(O)cc2Sc2ccccc21 |
| InChI | InChI=1S/C15H15NO2S.BrH/c1-16-11-6-9-7-12(17)13(18)8-15(9)19-14-5-3-2-4-10(11)14;/h2-5,7-8,11,16-18H,6H2,1H3;1H |
| InChIKey | BZEAZOHIIJAWME-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 6-(methylamino)-5,6-dihydrobenzo[b][1]benzothiepine-2,3-diol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methylamino)-5,6-dihydrobenzo[b][1]benzothiepine-2,3-diol;hydrobromide?
The IUPAC name of 6-(methylamino)-5,6-dihydrobenzo[b][1]benzothiepine-2,3-diol;hydrobromide (CID 3045604) is 6-(methylamino)-5,6-dihydrobenzo[b][1]benzothiepine-2,3-diol;hydrobromide.
What is the SMILES notation for 6-(methylamino)-5,6-dihydrobenzo[b][1]benzothiepine-2,3-diol;hydrobromide?
The canonical SMILES for 6-(methylamino)-5,6-dihydrobenzo[b][1]benzothiepine-2,3-diol;hydrobromide is Br.CNC1Cc2cc(O)c(O)cc2Sc2ccccc21.
What is the InChIKey of 6-(methylamino)-5,6-dihydrobenzo[b][1]benzothiepine-2,3-diol;hydrobromide?
The InChIKey is BZEAZOHIIJAWME-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2S.BrH/c1-16-11-6-9-7-12(17)13(18)8-15(9)19-14-5-3-2-4-10(11)14;/h2-5,7-8,11,16-18H,6H2,1H3;1H.
What are the key properties of 6-(methylamino)-5,6-dihydrobenzo[b][1]benzothiepine-2,3-diol;hydrobromide?
6-(methylamino)-5,6-dihydrobenzo[b][1]benzothiepine-2,3-diol;hydrobromide has a molecular weight of 354.27 g/mol, XLogP of 3.64, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methylamino)-5,6-dihydrobenzo[b][1]benzothiepine-2,3-diol;hydrobromide is sourced from PubChem (CID 3045604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).