C24H31N3O3 — CID 30456737
N-benzyl-2-[4-[3-(2,5-dimethylphenoxy)propanoyl]piperazin-1-yl]acetamide (PubChem CID 30456737) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-benzyl-2-[4-[3-(2,5-dimethylphenoxy)propanoyl]piperazin-1-yl]acetamide.
| Compound Name | N-benzyl-2-[4-[3-(2,5-dimethylphenoxy)propanoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 30456737 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | N-benzyl-2-[4-[3-(2,5-dimethylphenoxy)propanoyl]piperazin-1-yl]acetamide |
| SMILES | Cc1ccc(C)c(OCCC(=O)N2CCN(CC(=O)NCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C24H31N3O3/c1-19-8-9-20(2)22(16-19)30-15-10-24(29)27-13-11-26(12-14-27)18-23(28)25-17-21-6-4-3-5-7-21/h3-9,16H,10-15,17-18H2,1-2H3,(H,25,28) |
| InChIKey | ZLSIVONJQSVDDF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |