C23H28Cl2N2O2 — CID 3045893
ethyl 5-chloro-2-[2-(diethylamino)ethyl]-3-phenylisoindole-1-carboxylate;hydrochloride (PubChem CID 3045893) has the molecular formula C23H28Cl2N2O2 and a molecular weight of 435.40 g/mol. Its IUPAC name is ethyl 5-chloro-2-[2-(diethylamino)ethyl]-3-phenylisoindole-1-carboxylate;hydrochloride.
| Compound Name | ethyl 5-chloro-2-[2-(diethylamino)ethyl]-3-phenylisoindole-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 3045893 |
| Molecular Formula | C23H28Cl2N2O2 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | ethyl 5-chloro-2-[2-(diethylamino)ethyl]-3-phenylisoindole-1-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1c2ccc(Cl)cc2c(-c2ccccc2)n1CCN(CC)CC.Cl |
| InChI | InChI=1S/C23H27ClN2O2.ClH/c1-4-25(5-2)14-15-26-21(17-10-8-7-9-11-17)20-16-18(24)12-13-19(20)22(26)23(27)28-6-3;/h7-13,16H,4-6,14-15H2,1-3H3;1H |
| InChIKey | JARRFJLRNFBULQ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |