About 3-[4-(10H-thieno[3,4-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propan-1-ol
3-[4-(10H-thieno[3,4-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propan-1-ol (PubChem CID 3045938) has the molecular formula C18H22N4OS
and a molecular weight of 342.47 g/mol. Its IUPAC name is 3-[4-(10H-thieno[3,4-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[4-(10H-thieno[3,4-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propan-1-ol |
| PubChem CID | 3045938 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 3-[4-(10H-thieno[3,4-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propan-1-ol |
| SMILES | OCCCN1CCN(C2=Nc3ccccc3Nc3cscc32)CC1 |
| InChI | InChI=1S/C18H22N4OS/c23-11-3-6-21-7-9-22(10-8-21)18-14-12-24-13-17(14)19-15-4-1-2-5-16(15)20-18/h1-2,4-5,12-13,19,23H,3,6-11H2 |
| InChIKey | WTBGOGYUCIDREC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-(10H-thieno[3,4-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(10H-thieno[3,4-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propan-1-ol?
The IUPAC name of 3-[4-(10H-thieno[3,4-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propan-1-ol (CID 3045938) is 3-[4-(10H-thieno[3,4-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propan-1-ol.
What is the SMILES notation for 3-[4-(10H-thieno[3,4-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propan-1-ol?
The canonical SMILES for 3-[4-(10H-thieno[3,4-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propan-1-ol is OCCCN1CCN(C2=Nc3ccccc3Nc3cscc32)CC1.
What is the InChIKey of 3-[4-(10H-thieno[3,4-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propan-1-ol?
The InChIKey is WTBGOGYUCIDREC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4OS/c23-11-3-6-21-7-9-22(10-8-21)18-14-12-24-13-17(14)19-15-4-1-2-5-16(15)20-18/h1-2,4-5,12-13,19,23H,3,6-11H2.
What are the key properties of 3-[4-(10H-thieno[3,4-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propan-1-ol?
3-[4-(10H-thieno[3,4-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propan-1-ol has a molecular weight of 342.47 g/mol, XLogP of 2.88, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(10H-thieno[3,4-b][1,5]benzodiazepin-4-yl)piperazin-1-yl]propan-1-ol is sourced from PubChem (CID 3045938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).