C21H21N3O2 — CID 3045956
1-[(5-methoxy-1H-indol-3-yl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-6-ol (PubChem CID 3045956) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-[(5-methoxy-1H-indol-3-yl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-6-ol.
| Compound Name | 1-[(5-methoxy-1H-indol-3-yl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-6-ol |
|---|---|
| PubChem CID | 3045956 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1-[(5-methoxy-1H-indol-3-yl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-6-ol |
| SMILES | COc1ccc2[nH]cc(CC3NCCc4c3[nH]c3ccc(O)cc43)c2c1 |
| InChI | InChI=1S/C21H21N3O2/c1-26-14-3-5-18-16(10-14)12(11-23-18)8-20-21-15(6-7-22-20)17-9-13(25)2-4-19(17)24-21/h2-5,9-11,20,22-25H,6-8H2,1H3 |
| InChIKey | LWCWZJHVEYXSKP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|