C21H22ClN3O — CID 3045957
1-(1H-indol-3-ylmethyl)-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride (PubChem CID 3045957) has the molecular formula C21H22ClN3O and a molecular weight of 367.88 g/mol. Its IUPAC name is 1-(1H-indol-3-ylmethyl)-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride.
| Compound Name | 1-(1H-indol-3-ylmethyl)-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
|---|---|
| PubChem CID | 3045957 |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-(1H-indol-3-ylmethyl)-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCNC3Cc1c[nH]c2ccccc12.Cl |
| InChI | InChI=1S/C21H21N3O.ClH/c1-25-14-6-7-19-17(11-14)16-8-9-22-20(21(16)24-19)10-13-12-23-18-5-3-2-4-15(13)18;/h2-7,11-12,20,22-24H,8-10H2,1H3;1H |
| InChIKey | NEMZWIAZCOGMNJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 52.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|