C34H32ClN3O2 — CID 3045968
6-phenylmethoxy-1-[(5-phenylmethoxy-1H-indol-3-yl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride (PubChem CID 3045968) has the molecular formula C34H32ClN3O2 and a molecular weight of 550.10 g/mol. Its IUPAC name is 6-phenylmethoxy-1-[(5-phenylmethoxy-1H-indol-3-yl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride.
| Compound Name | 6-phenylmethoxy-1-[(5-phenylmethoxy-1H-indol-3-yl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
|---|---|
| PubChem CID | 3045968 |
| Molecular Formula | C34H32ClN3O2 |
| Molecular Weight | 550.10 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 6-phenylmethoxy-1-[(5-phenylmethoxy-1H-indol-3-yl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
| SMILES | Cl.c1ccc(COc2ccc3[nH]cc(CC4NCCc5c4[nH]c4ccc(OCc6ccccc6)cc54)c3c2)cc1 |
| InChI | InChI=1S/C34H31N3O2.ClH/c1-3-7-23(8-4-1)21-38-26-11-13-31-29(18-26)25(20-36-31)17-33-34-28(15-16-35-33)30-19-27(12-14-32(30)37-34)39-22-24-9-5-2-6-10-24;/h1-14,18-20,33,35-37H,15-17,21-22H2;1H |
| InChIKey | YFTRXMLUDFSAGN-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 62.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.10 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|