About 1-(1-benzothiophen-3-yl)-4-(dipropylamino)butan-1-one;hydrobromide
1-(1-benzothiophen-3-yl)-4-(dipropylamino)butan-1-one;hydrobromide (PubChem CID 3046053) has the molecular formula C18H26BrNOS
and a molecular weight of 384.38 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-4-(dipropylamino)butan-1-one;hydrobromide.
Molecular Properties
| Compound Name | 1-(1-benzothiophen-3-yl)-4-(dipropylamino)butan-1-one;hydrobromide |
| PubChem CID | 3046053 |
| Molecular Formula | C18H26BrNOS |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-4-(dipropylamino)butan-1-one;hydrobromide |
| SMILES | Br.CCCN(CCC)CCCC(=O)c1csc2ccccc12 |
| InChI | InChI=1S/C18H25NOS.BrH/c1-3-11-19(12-4-2)13-7-9-17(20)16-14-21-18-10-6-5-8-15(16)18;/h5-6,8,10,14H,3-4,7,9,11-13H2,1-2H3;1H |
| InChIKey | CBGQSGAJESOAHJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-benzothiophen-3-yl)-4-(dipropylamino)butan-1-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-benzothiophen-3-yl)-4-(dipropylamino)butan-1-one;hydrobromide?
The IUPAC name of 1-(1-benzothiophen-3-yl)-4-(dipropylamino)butan-1-one;hydrobromide (CID 3046053) is 1-(1-benzothiophen-3-yl)-4-(dipropylamino)butan-1-one;hydrobromide.
What is the SMILES notation for 1-(1-benzothiophen-3-yl)-4-(dipropylamino)butan-1-one;hydrobromide?
The canonical SMILES for 1-(1-benzothiophen-3-yl)-4-(dipropylamino)butan-1-one;hydrobromide is Br.CCCN(CCC)CCCC(=O)c1csc2ccccc12.
What is the InChIKey of 1-(1-benzothiophen-3-yl)-4-(dipropylamino)butan-1-one;hydrobromide?
The InChIKey is CBGQSGAJESOAHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NOS.BrH/c1-3-11-19(12-4-2)13-7-9-17(20)16-14-21-18-10-6-5-8-15(16)18;/h5-6,8,10,14H,3-4,7,9,11-13H2,1-2H3;1H.
What are the key properties of 1-(1-benzothiophen-3-yl)-4-(dipropylamino)butan-1-one;hydrobromide?
1-(1-benzothiophen-3-yl)-4-(dipropylamino)butan-1-one;hydrobromide has a molecular weight of 384.38 g/mol, XLogP of 5.56, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-benzothiophen-3-yl)-4-(dipropylamino)butan-1-one;hydrobromide is sourced from PubChem (CID 3046053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).