About propylcarbamoyl (2R)-2-acetamido-3-sulfanylpropanoate
propylcarbamoyl (2R)-2-acetamido-3-sulfanylpropanoate (PubChem CID 3046208) has the molecular formula C9H16N2O4S
and a molecular weight of 248.30 g/mol. Its IUPAC name is propylcarbamoyl (2R)-2-acetamido-3-sulfanylpropanoate.
Molecular Properties
| Compound Name | propylcarbamoyl (2R)-2-acetamido-3-sulfanylpropanoate |
| PubChem CID | 3046208 |
| Molecular Formula | C9H16N2O4S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | propylcarbamoyl (2R)-2-acetamido-3-sulfanylpropanoate |
| SMILES | CCCNC(=O)OC(=O)[C@H](CS)NC(C)=O |
| InChI | InChI=1S/C9H16N2O4S/c1-3-4-10-9(14)15-8(13)7(5-16)11-6(2)12/h7,16H,3-5H2,1-2H3,(H,10,14)(H,11,12)/t7-/m0/s1 |
| InChIKey | XXLMCIQHOWWTCM-ZETCQYMHSA-N |
| XLogP | 0.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze propylcarbamoyl (2R)-2-acetamido-3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propylcarbamoyl (2R)-2-acetamido-3-sulfanylpropanoate?
The IUPAC name of propylcarbamoyl (2R)-2-acetamido-3-sulfanylpropanoate (CID 3046208) is propylcarbamoyl (2R)-2-acetamido-3-sulfanylpropanoate.
What is the SMILES notation for propylcarbamoyl (2R)-2-acetamido-3-sulfanylpropanoate?
The canonical SMILES for propylcarbamoyl (2R)-2-acetamido-3-sulfanylpropanoate is CCCNC(=O)OC(=O)[C@H](CS)NC(C)=O.
What is the InChIKey of propylcarbamoyl (2R)-2-acetamido-3-sulfanylpropanoate?
The InChIKey is XXLMCIQHOWWTCM-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H16N2O4S/c1-3-4-10-9(14)15-8(13)7(5-16)11-6(2)12/h7,16H,3-5H2,1-2H3,(H,10,14)(H,11,12)/t7-/m0/s1.
What are the key properties of propylcarbamoyl (2R)-2-acetamido-3-sulfanylpropanoate?
propylcarbamoyl (2R)-2-acetamido-3-sulfanylpropanoate has a molecular weight of 248.30 g/mol, XLogP of 0.08, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propylcarbamoyl (2R)-2-acetamido-3-sulfanylpropanoate is sourced from PubChem (CID 3046208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).