About N,N-dimethyl-N'-(1-phenylpropan-2-yl)ethanimidamide
N,N-dimethyl-N'-(1-phenylpropan-2-yl)ethanimidamide (PubChem CID 3046297) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is N,N-dimethyl-N'-(1-phenylpropan-2-yl)ethanimidamide.
Molecular Properties
| Compound Name | N,N-dimethyl-N'-(1-phenylpropan-2-yl)ethanimidamide |
| PubChem CID | 3046297 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N,N-dimethyl-N'-(1-phenylpropan-2-yl)ethanimidamide |
| SMILES | C/C(=N\C(C)Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C13H20N2/c1-11(14-12(2)15(3)4)10-13-8-6-5-7-9-13/h5-9,11H,10H2,1-4H3/b14-12+ |
| InChIKey | QHNQKCXRMUHPBT-WYMLVPIESA-N |
| XLogP | 2.60 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-N'-(1-phenylpropan-2-yl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-N'-(1-phenylpropan-2-yl)ethanimidamide?
The IUPAC name of N,N-dimethyl-N'-(1-phenylpropan-2-yl)ethanimidamide (CID 3046297) is N,N-dimethyl-N'-(1-phenylpropan-2-yl)ethanimidamide.
What is the SMILES notation for N,N-dimethyl-N'-(1-phenylpropan-2-yl)ethanimidamide?
The canonical SMILES for N,N-dimethyl-N'-(1-phenylpropan-2-yl)ethanimidamide is C/C(=N\C(C)Cc1ccccc1)N(C)C.
What is the InChIKey of N,N-dimethyl-N'-(1-phenylpropan-2-yl)ethanimidamide?
The InChIKey is QHNQKCXRMUHPBT-WYMLVPIESA-N. The full InChI is InChI=1S/C13H20N2/c1-11(14-12(2)15(3)4)10-13-8-6-5-7-9-13/h5-9,11H,10H2,1-4H3/b14-12+.
What are the key properties of N,N-dimethyl-N'-(1-phenylpropan-2-yl)ethanimidamide?
N,N-dimethyl-N'-(1-phenylpropan-2-yl)ethanimidamide has a molecular weight of 204.32 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-N'-(1-phenylpropan-2-yl)ethanimidamide is sourced from PubChem (CID 3046297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).