About N-benzyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;methanesulfonic acid
N-benzyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;methanesulfonic acid (PubChem CID 3046411) has the molecular formula C18H22F3NO3S
and a molecular weight of 389.44 g/mol. Its IUPAC name is N-benzyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;methanesulfonic acid.
Molecular Properties
| Compound Name | N-benzyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;methanesulfonic acid |
| PubChem CID | 3046411 |
| Molecular Formula | C18H22F3NO3S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | N-benzyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;methanesulfonic acid |
| SMILES | CC(Cc1cccc(C(F)(F)F)c1)NCc1ccccc1.CS(=O)(=O)O |
| InChI | InChI=1S/C17H18F3N.CH4O3S/c1-13(21-12-14-6-3-2-4-7-14)10-15-8-5-9-16(11-15)17(18,19)20;1-5(2,3)4/h2-9,11,13,21H,10,12H2,1H3;1H3,(H,2,3,4) |
| InChIKey | SPXOPIMGAZEYQY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;methanesulfonic acid?
The IUPAC name of N-benzyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;methanesulfonic acid (CID 3046411) is N-benzyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;methanesulfonic acid.
What is the SMILES notation for N-benzyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;methanesulfonic acid?
The canonical SMILES for N-benzyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;methanesulfonic acid is CC(Cc1cccc(C(F)(F)F)c1)NCc1ccccc1.CS(=O)(=O)O.
What is the InChIKey of N-benzyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;methanesulfonic acid?
The InChIKey is SPXOPIMGAZEYQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F3N.CH4O3S/c1-13(21-12-14-6-3-2-4-7-14)10-15-8-5-9-16(11-15)17(18,19)20;1-5(2,3)4/h2-9,11,13,21H,10,12H2,1H3;1H3,(H,2,3,4).
What are the key properties of N-benzyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;methanesulfonic acid?
N-benzyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;methanesulfonic acid has a molecular weight of 389.44 g/mol, XLogP of 3.93, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;methanesulfonic acid is sourced from PubChem (CID 3046411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).