About 2-[4-(difluoromethoxy)phenyl]-1,5-dimethylpyrazol-3-one
2-[4-(difluoromethoxy)phenyl]-1,5-dimethylpyrazol-3-one (PubChem CID 3046480) has the molecular formula C12H12F2N2O2
and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)phenyl]-1,5-dimethylpyrazol-3-one.
Molecular Properties
| Compound Name | 2-[4-(difluoromethoxy)phenyl]-1,5-dimethylpyrazol-3-one |
| PubChem CID | 3046480 |
| Molecular Formula | C12H12F2N2O2 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-[4-(difluoromethoxy)phenyl]-1,5-dimethylpyrazol-3-one |
| SMILES | Cc1cc(=O)n(-c2ccc(OC(F)F)cc2)n1C |
| InChI | InChI=1S/C12H12F2N2O2/c1-8-7-11(17)16(15(8)2)9-3-5-10(6-4-9)18-12(13)14/h3-7,12H,1-2H3 |
| InChIKey | VJHTVAONVMKOEL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(difluoromethoxy)phenyl]-1,5-dimethylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(difluoromethoxy)phenyl]-1,5-dimethylpyrazol-3-one?
The IUPAC name of 2-[4-(difluoromethoxy)phenyl]-1,5-dimethylpyrazol-3-one (CID 3046480) is 2-[4-(difluoromethoxy)phenyl]-1,5-dimethylpyrazol-3-one.
What is the SMILES notation for 2-[4-(difluoromethoxy)phenyl]-1,5-dimethylpyrazol-3-one?
The canonical SMILES for 2-[4-(difluoromethoxy)phenyl]-1,5-dimethylpyrazol-3-one is Cc1cc(=O)n(-c2ccc(OC(F)F)cc2)n1C.
What is the InChIKey of 2-[4-(difluoromethoxy)phenyl]-1,5-dimethylpyrazol-3-one?
The InChIKey is VJHTVAONVMKOEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2N2O2/c1-8-7-11(17)16(15(8)2)9-3-5-10(6-4-9)18-12(13)14/h3-7,12H,1-2H3.
What are the key properties of 2-[4-(difluoromethoxy)phenyl]-1,5-dimethylpyrazol-3-one?
2-[4-(difluoromethoxy)phenyl]-1,5-dimethylpyrazol-3-one has a molecular weight of 254.24 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(difluoromethoxy)phenyl]-1,5-dimethylpyrazol-3-one is sourced from PubChem (CID 3046480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).