C16H11N7OS — CID 30464930
(7S)-7-phenyl-5-sulfanylidene-3,4,6,11,12,14,16-heptazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),8,12,14,16-pentaen-2-one (PubChem CID 30464930) has the molecular formula C16H11N7OS and a molecular weight of 349.38 g/mol. Its IUPAC name is (7S)-7-phenyl-5-sulfanylidene-3,4,6,11,12,14,16-heptazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),8,12,14,16-pentaen-2-one.
| Compound Name | (7S)-7-phenyl-5-sulfanylidene-3,4,6,11,12,14,16-heptazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),8,12,14,16-pentaen-2-one |
|---|---|
| PubChem CID | 30464930 |
| Molecular Formula | C16H11N7OS |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (7S)-7-phenyl-5-sulfanylidene-3,4,6,11,12,14,16-heptazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),8,12,14,16-pentaen-2-one |
| SMILES | O=c1c2cnc3ncnn3c2cc2n1NC(=S)N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C16H11N7OS/c24-14-10-7-17-15-18-8-19-23(15)11(10)6-12-13(9-4-2-1-3-5-9)20-16(25)21-22(12)14/h1-8,13H,(H2,20,21,25)/t13-/m0/s1 |
| InChIKey | ISNDGLLVFJUXCC-ZDUSSCGKSA-N |
| XLogP | 0.96 |
| TPSA | 89.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|