About N-(4-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide
N-(4-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide (PubChem CID 30465279) has the molecular formula C10H15N5O
and a molecular weight of 221.26 g/mol. Its IUPAC name is N-(4-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide |
| PubChem CID | 30465279 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | N-(4-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide |
| SMILES | CC(=O)Nc1ncnc(N2CCCCC2)n1 |
| InChI | InChI=1S/C10H15N5O/c1-8(16)13-9-11-7-12-10(14-9)15-5-3-2-4-6-15/h7H,2-6H2,1H3,(H,11,12,13,14,16) |
| InChIKey | KDULETZEWXSVMR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide?
The IUPAC name of N-(4-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide (CID 30465279) is N-(4-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide.
What is the SMILES notation for N-(4-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide?
The canonical SMILES for N-(4-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide is CC(=O)Nc1ncnc(N2CCCCC2)n1.
What is the InChIKey of N-(4-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide?
The InChIKey is KDULETZEWXSVMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O/c1-8(16)13-9-11-7-12-10(14-9)15-5-3-2-4-6-15/h7H,2-6H2,1H3,(H,11,12,13,14,16).
What are the key properties of N-(4-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide?
N-(4-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide has a molecular weight of 221.26 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-piperidin-1-yl-1,3,5-triazin-2-yl)acetamide is sourced from PubChem (CID 30465279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).