About 6-[(2-chloro-1,1-dioxo-1-benzothiophen-3-yl)amino]hexan-1-ol
6-[(2-chloro-1,1-dioxo-1-benzothiophen-3-yl)amino]hexan-1-ol (PubChem CID 3046528) has the molecular formula C14H18ClNO3S
and a molecular weight of 315.82 g/mol. Its IUPAC name is 6-[(2-chloro-1,1-dioxo-1-benzothiophen-3-yl)amino]hexan-1-ol.
Molecular Properties
| Compound Name | 6-[(2-chloro-1,1-dioxo-1-benzothiophen-3-yl)amino]hexan-1-ol |
| PubChem CID | 3046528 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 6-[(2-chloro-1,1-dioxo-1-benzothiophen-3-yl)amino]hexan-1-ol |
| SMILES | O=S1(=O)C(Cl)=C(NCCCCCCO)c2ccccc21 |
| InChI | InChI=1S/C14H18ClNO3S/c15-14-13(16-9-5-1-2-6-10-17)11-7-3-4-8-12(11)20(14,18)19/h3-4,7-8,16-17H,1-2,5-6,9-10H2 |
| InChIKey | GPQUXWOMLIXRJB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2-chloro-1,1-dioxo-1-benzothiophen-3-yl)amino]hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2-chloro-1,1-dioxo-1-benzothiophen-3-yl)amino]hexan-1-ol?
The IUPAC name of 6-[(2-chloro-1,1-dioxo-1-benzothiophen-3-yl)amino]hexan-1-ol (CID 3046528) is 6-[(2-chloro-1,1-dioxo-1-benzothiophen-3-yl)amino]hexan-1-ol.
What is the SMILES notation for 6-[(2-chloro-1,1-dioxo-1-benzothiophen-3-yl)amino]hexan-1-ol?
The canonical SMILES for 6-[(2-chloro-1,1-dioxo-1-benzothiophen-3-yl)amino]hexan-1-ol is O=S1(=O)C(Cl)=C(NCCCCCCO)c2ccccc21.
What is the InChIKey of 6-[(2-chloro-1,1-dioxo-1-benzothiophen-3-yl)amino]hexan-1-ol?
The InChIKey is GPQUXWOMLIXRJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClNO3S/c15-14-13(16-9-5-1-2-6-10-17)11-7-3-4-8-12(11)20(14,18)19/h3-4,7-8,16-17H,1-2,5-6,9-10H2.
What are the key properties of 6-[(2-chloro-1,1-dioxo-1-benzothiophen-3-yl)amino]hexan-1-ol?
6-[(2-chloro-1,1-dioxo-1-benzothiophen-3-yl)amino]hexan-1-ol has a molecular weight of 315.82 g/mol, XLogP of 2.48, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2-chloro-1,1-dioxo-1-benzothiophen-3-yl)amino]hexan-1-ol is sourced from PubChem (CID 3046528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).