C23H20N4O2 — CID 30465959
2-[2-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]acetonitrile (PubChem CID 30465959) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-[2-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]acetonitrile.
| Compound Name | 2-[2-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]acetonitrile |
|---|---|
| PubChem CID | 30465959 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-[2-[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]acetonitrile |
| SMILES | N#CCn1c2c(c3ccccc31)CCN([C@@H]1CC(=O)N(c3ccccc3)C1=O)C2 |
| InChI | InChI=1S/C23H20N4O2/c24-11-13-26-19-9-5-4-8-17(19)18-10-12-25(15-21(18)26)20-14-22(28)27(23(20)29)16-6-2-1-3-7-16/h1-9,20H,10,12-15H2/t20-/m1/s1 |
| InChIKey | IRFGPMKEEWPYBR-HXUWFJFHSA-N |
| XLogP | 2.86 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|