C21H16N4O3 — CID 30466256
5-(2,4-dimethoxyphenyl)-1,5,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,8,10,12,14,16-heptaen-6-one (PubChem CID 30466256) has the molecular formula C21H16N4O3 and a molecular weight of 372.38 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-1,5,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,8,10,12,14,16-heptaen-6-one.
| Compound Name | 5-(2,4-dimethoxyphenyl)-1,5,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,8,10,12,14,16-heptaen-6-one |
|---|---|
| PubChem CID | 30466256 |
| Molecular Formula | C21H16N4O3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-1,5,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,8,10,12,14,16-heptaen-6-one |
| SMILES | COc1ccc(-n2ccc3c(cnc4nc5ccccc5n43)c2=O)c(OC)c1 |
| InChI | InChI=1S/C21H16N4O3/c1-27-13-7-8-18(19(11-13)28-2)24-10-9-16-14(20(24)26)12-22-21-23-15-5-3-4-6-17(15)25(16)21/h3-12H,1-2H3 |
| InChIKey | KRYOOCYFXJVVJF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |