C20H13N5O3 — CID 30466258
5-(2-methyl-4-nitrophenyl)-1,5,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,8,10,12,14,16-heptaen-6-one (PubChem CID 30466258) has the molecular formula C20H13N5O3 and a molecular weight of 371.36 g/mol. Its IUPAC name is 5-(2-methyl-4-nitrophenyl)-1,5,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,8,10,12,14,16-heptaen-6-one.
| Compound Name | 5-(2-methyl-4-nitrophenyl)-1,5,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,8,10,12,14,16-heptaen-6-one |
|---|---|
| PubChem CID | 30466258 |
| Molecular Formula | C20H13N5O3 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 5-(2-methyl-4-nitrophenyl)-1,5,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,8,10,12,14,16-heptaen-6-one |
| SMILES | Cc1cc([N+](=O)[O-])ccc1-n1ccc2c(cnc3nc4ccccc4n32)c1=O |
| InChI | InChI=1S/C20H13N5O3/c1-12-10-13(25(27)28)6-7-16(12)23-9-8-17-14(19(23)26)11-21-20-22-15-4-2-3-5-18(15)24(17)20/h2-11H,1H3 |
| InChIKey | CYQKJNPKVCLABJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|