C17H25FN4O2S — CID 30466413
N-[3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]-4-fluorobenzenesulfonamide (PubChem CID 30466413) has the molecular formula C17H25FN4O2S and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 30466413 |
| Molecular Formula | C17H25FN4O2S |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[3-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]-4-fluorobenzenesulfonamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1N1CN=C(NS(=O)(=O)c2ccc(F)cc2)NC1 |
| InChI | InChI=1S/C17H25FN4O2S/c1-12-4-3-5-16(13(12)2)22-10-19-17(20-11-22)21-25(23,24)15-8-6-14(18)7-9-15/h6-9,12-13,16H,3-5,10-11H2,1-2H3,(H2,19,20,21)/t12-,13-,16+/m1/s1 |
| InChIKey | CBRVECYDAHLVGN-IOASZLSFSA-N |
| XLogP | 2.10 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |