About 1,3-di(piperidin-1-yl)propan-2-yl 2,2-diphenylacetate
1,3-di(piperidin-1-yl)propan-2-yl 2,2-diphenylacetate (PubChem CID 3046647) has the molecular formula C27H36N2O2
and a molecular weight of 420.60 g/mol. Its IUPAC name is 1,3-di(piperidin-1-yl)propan-2-yl 2,2-diphenylacetate.
Molecular Properties
| Compound Name | 1,3-di(piperidin-1-yl)propan-2-yl 2,2-diphenylacetate |
| PubChem CID | 3046647 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 1,3-di(piperidin-1-yl)propan-2-yl 2,2-diphenylacetate |
| SMILES | O=C(OC(CN1CCCCC1)CN1CCCCC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H36N2O2/c30-27(26(23-13-5-1-6-14-23)24-15-7-2-8-16-24)31-25(21-28-17-9-3-10-18-28)22-29-19-11-4-12-20-29/h1-2,5-8,13-16,25-26H,3-4,9-12,17-22H2 |
| InChIKey | PMKUJWAYASFVCU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-di(piperidin-1-yl)propan-2-yl 2,2-diphenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-di(piperidin-1-yl)propan-2-yl 2,2-diphenylacetate?
The IUPAC name of 1,3-di(piperidin-1-yl)propan-2-yl 2,2-diphenylacetate (CID 3046647) is 1,3-di(piperidin-1-yl)propan-2-yl 2,2-diphenylacetate.
What is the SMILES notation for 1,3-di(piperidin-1-yl)propan-2-yl 2,2-diphenylacetate?
The canonical SMILES for 1,3-di(piperidin-1-yl)propan-2-yl 2,2-diphenylacetate is O=C(OC(CN1CCCCC1)CN1CCCCC1)C(c1ccccc1)c1ccccc1.
What is the InChIKey of 1,3-di(piperidin-1-yl)propan-2-yl 2,2-diphenylacetate?
The InChIKey is PMKUJWAYASFVCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H36N2O2/c30-27(26(23-13-5-1-6-14-23)24-15-7-2-8-16-24)31-25(21-28-17-9-3-10-18-28)22-29-19-11-4-12-20-29/h1-2,5-8,13-16,25-26H,3-4,9-12,17-22H2.
What are the key properties of 1,3-di(piperidin-1-yl)propan-2-yl 2,2-diphenylacetate?
1,3-di(piperidin-1-yl)propan-2-yl 2,2-diphenylacetate has a molecular weight of 420.60 g/mol, XLogP of 4.70, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-di(piperidin-1-yl)propan-2-yl 2,2-diphenylacetate is sourced from PubChem (CID 3046647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).